C30H37N3O3S — CID 67701164
1-[[4-(benzenesulfonamido)phenyl]methyl]-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea (PubChem CID 67701164) has the molecular formula C30H37N3O3S and a molecular weight of 519.71 g/mol. Its IUPAC name is 1-[[4-(benzenesulfonamido)phenyl]methyl]-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[[4-(benzenesulfonamido)phenyl]methyl]-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 67701164 |
| Molecular Formula | C30H37N3O3S |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.26 |
| IUPAC Name | 1-[[4-(benzenesulfonamido)phenyl]methyl]-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc(NS(=O)(=O)c3ccccc3)cc2)C2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C30H37N3O3S/c1-22-19-23(2)29(24(3)20-22)31-30(34)33(27-11-7-4-5-8-12-27)21-25-15-17-26(18-16-25)32-37(35,36)28-13-9-6-10-14-28/h6,9-10,13-20,27,32H,4-5,7-8,11-12,21H2,1-3H3,(H,31,34) |
| InChIKey | YBKOFAFNPILGFC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |