C30H34N2O — CID 19936129
1-(biphenylen-2-ylmethyl)-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea (PubChem CID 19936129) has the molecular formula C30H34N2O and a molecular weight of 438.62 g/mol. Its IUPAC name is 1-(biphenylen-2-ylmethyl)-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(biphenylen-2-ylmethyl)-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 19936129 |
| Molecular Formula | C30H34N2O |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-(biphenylen-2-ylmethyl)-1-cycloheptyl-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc3c(c2)-c2ccccc2-3)C2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C30H34N2O/c1-20-16-21(2)29(22(3)17-20)31-30(33)32(24-10-6-4-5-7-11-24)19-23-14-15-27-25-12-8-9-13-26(25)28(27)18-23/h8-9,12-18,24H,4-7,10-11,19H2,1-3H3,(H,31,33) |
| InChIKey | JLKULLFZAIKNDN-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |