C31H37N3O2 — CID 67699000
N-[4-[[cycloheptyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]methyl]phenyl]benzamide (PubChem CID 67699000) has the molecular formula C31H37N3O2 and a molecular weight of 483.66 g/mol. Its IUPAC name is N-[4-[[cycloheptyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]methyl]phenyl]benzamide.
| Compound Name | N-[4-[[cycloheptyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 67699000 |
| Molecular Formula | C31H37N3O2 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.29 |
| IUPAC Name | N-[4-[[cycloheptyl-[(2,4,6-trimethylphenyl)carbamoyl]amino]methyl]phenyl]benzamide |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc(NC(=O)c3ccccc3)cc2)C2CCCCCC2)c(C)c1 |
| InChI | InChI=1S/C31H37N3O2/c1-22-19-23(2)29(24(3)20-22)33-31(36)34(28-13-9-4-5-10-14-28)21-25-15-17-27(18-16-25)32-30(35)26-11-7-6-8-12-26/h6-8,11-12,15-20,28H,4-5,9-10,13-14,21H2,1-3H3,(H,32,35)(H,33,36) |
| InChIKey | XTJZNXPVJFTZNJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |