C34H39F3N2O4S — CID 20742345
3-[[4-[2-(4-tert-butylcyclohexyl)-3-oxo-3-[3-thiophen-3-yl-5-(trifluoromethyl)anilino]propyl]benzoyl]amino]propanoic acid (PubChem CID 20742345) has the molecular formula C34H39F3N2O4S and a molecular weight of 628.76 g/mol. Its IUPAC name is 3-[[4-[2-(4-tert-butylcyclohexyl)-3-oxo-3-[3-thiophen-3-yl-5-(trifluoromethyl)anilino]propyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[2-(4-tert-butylcyclohexyl)-3-oxo-3-[3-thiophen-3-yl-5-(trifluoromethyl)anilino]propyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742345 |
| Molecular Formula | C34H39F3N2O4S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 3-[[4-[2-(4-tert-butylcyclohexyl)-3-oxo-3-[3-thiophen-3-yl-5-(trifluoromethyl)anilino]propyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(C(Cc2ccc(C(=O)NCCC(=O)O)cc2)C(=O)Nc2cc(-c3ccsc3)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C34H39F3N2O4S/c1-33(2,3)26-10-8-22(9-11-26)29(16-21-4-6-23(7-5-21)31(42)38-14-12-30(40)41)32(43)39-28-18-25(24-13-15-44-20-24)17-27(19-28)34(35,36)37/h4-7,13,15,17-20,22,26,29H,8-12,14,16H2,1-3H3,(H,38,42)(H,39,43)(H,40,41) |
| InChIKey | ZEUWLOPBNJWHJP-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |