C34H45F3N2O5 — CID 20742232
3-[[4-[3-[4-butoxy-3-(trifluoromethyl)anilino]-2-(4-tert-butylcyclohexyl)-3-oxopropyl]benzoyl]amino]propanoic acid (PubChem CID 20742232) has the molecular formula C34H45F3N2O5 and a molecular weight of 618.74 g/mol. Its IUPAC name is 3-[[4-[3-[4-butoxy-3-(trifluoromethyl)anilino]-2-(4-tert-butylcyclohexyl)-3-oxopropyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-[4-butoxy-3-(trifluoromethyl)anilino]-2-(4-tert-butylcyclohexyl)-3-oxopropyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 20742232 |
| Molecular Formula | C34H45F3N2O5 |
| Molecular Weight | 618.74 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 3-[[4-[3-[4-butoxy-3-(trifluoromethyl)anilino]-2-(4-tert-butylcyclohexyl)-3-oxopropyl]benzoyl]amino]propanoic acid |
| SMILES | CCCCOc1ccc(NC(=O)C(Cc2ccc(C(=O)NCCC(=O)O)cc2)C2CCC(C(C)(C)C)CC2)cc1C(F)(F)F |
| InChI | InChI=1S/C34H45F3N2O5/c1-5-6-19-44-29-16-15-26(21-28(29)34(35,36)37)39-32(43)27(23-11-13-25(14-12-23)33(2,3)4)20-22-7-9-24(10-8-22)31(42)38-18-17-30(40)41/h7-10,15-16,21,23,25,27H,5-6,11-14,17-20H2,1-4H3,(H,38,42)(H,39,43)(H,40,41) |
| InChIKey | YFMKLJXSTWEVGK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.74 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|