C29H35Cl2N3O4 — CID 57453246
3-[[4-[3-(4-tert-butylcyclohexyl)-2-(2,4-dichlorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid (PubChem CID 57453246) has the molecular formula C29H35Cl2N3O4 and a molecular weight of 560.52 g/mol. Its IUPAC name is 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(2,4-dichlorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(2,4-dichlorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 57453246 |
| Molecular Formula | C29H35Cl2N3O4 |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(2,4-dichlorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(N2/C(=N/c3ccc(Cl)cc3Cl)OCC2c2ccc(C(=O)NCCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C29H35Cl2N3O4/c1-29(2,3)20-8-11-22(12-9-20)34-25(17-38-28(34)33-24-13-10-21(30)16-23(24)31)18-4-6-19(7-5-18)27(37)32-15-14-26(35)36/h4-7,10,13,16,20,22,25H,8-9,11-12,14-15,17H2,1-3H3,(H,32,37)(H,35,36)/b33-28- |
| InChIKey | VYKNRGFQXAZSQY-MDVFONAFSA-N |
| XLogP | 6.86 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|