C29H36FN3O4 — CID 67482836
3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-fluorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid (PubChem CID 67482836) has the molecular formula C29H36FN3O4 and a molecular weight of 509.62 g/mol. Its IUPAC name is 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-fluorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-fluorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67482836 |
| Molecular Formula | C29H36FN3O4 |
| Molecular Weight | 509.62 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-fluorophenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(N2/C(=N/c3cccc(F)c3)OCC2c2ccc(C(=O)NCCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C29H36FN3O4/c1-29(2,3)21-11-13-24(14-12-21)33-25(18-37-28(33)32-23-6-4-5-22(30)17-23)19-7-9-20(10-8-19)27(36)31-16-15-26(34)35/h4-10,17,21,24-25H,11-16,18H2,1-3H3,(H,31,36)(H,34,35)/b32-28- |
| InChIKey | ZBYIFMHVEWXNGH-BLCKFSMSSA-N |
| XLogP | 5.70 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.62 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|