C30H39N3O4 — CID 67482971
3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid (PubChem CID 67482971) has the molecular formula C30H39N3O4 and a molecular weight of 505.66 g/mol. Its IUPAC name is 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 67482971 |
| Molecular Formula | C30H39N3O4 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.29 |
| IUPAC Name | 3-[[4-[3-(4-tert-butylcyclohexyl)-2-(3-methylphenyl)imino-1,3-oxazolidin-4-yl]benzoyl]amino]propanoic acid |
| SMILES | Cc1cccc(/N=C2\OCC(c3ccc(C(=O)NCCC(=O)O)cc3)N2C2CCC(C(C)(C)C)CC2)c1 |
| InChI | InChI=1S/C30H39N3O4/c1-20-6-5-7-24(18-20)32-29-33(25-14-12-23(13-15-25)30(2,3)4)26(19-37-29)21-8-10-22(11-9-21)28(36)31-17-16-27(34)35/h5-11,18,23,25-26H,12-17,19H2,1-4H3,(H,31,36)(H,34,35)/b32-29- |
| InChIKey | GBTPAWJAAZUWDF-OVXWJCGASA-N |
| XLogP | 5.87 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|