C31H43Cl2N5O — CID 152769279
4-[[N-(4-tert-butylcyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide (PubChem CID 152769279) has the molecular formula C31H43Cl2N5O and a molecular weight of 572.63 g/mol. Its IUPAC name is 4-[[N-(4-tert-butylcyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide.
| Compound Name | 4-[[N-(4-tert-butylcyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 152769279 |
| Molecular Formula | C31H43Cl2N5O |
| Molecular Weight | 572.63 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | 4-[[N-(4-tert-butylcyclohexyl)-C-[(3S)-3-methylpiperazin-1-yl]carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]benzamide |
| SMILES | C[C@H]1CN(/C(=N\C2CCC(C(C)(C)C)CC2)Nc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C31H43Cl2N5O/c1-21-20-38(18-17-34-21)30(37-27-13-8-24(9-14-27)31(2,3)4)36-26-11-6-23(7-12-26)29(39)35-16-15-22-5-10-25(32)19-28(22)33/h5-7,10-12,19,21,24,27,34H,8-9,13-18,20H2,1-4H3,(H,35,39)(H,36,37)/t21-,24?,27?/m0/s1 |
| InChIKey | USWHHDMNIBDTSL-VVJOPDHISA-N |
| XLogP | 6.63 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.63 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|