C27H33Cl2N5O2 — CID 68956025
3-(2,4-dichlorophenyl)-3-[4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(4-oxocyclohexyl)carbonimidoyl]amino]phenyl]propanamide (PubChem CID 68956025) has the molecular formula C27H33Cl2N5O2 and a molecular weight of 530.50 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-3-[4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(4-oxocyclohexyl)carbonimidoyl]amino]phenyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-3-[4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(4-oxocyclohexyl)carbonimidoyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 68956025 |
| Molecular Formula | C27H33Cl2N5O2 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 529.20 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-3-[4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(4-oxocyclohexyl)carbonimidoyl]amino]phenyl]propanamide |
| SMILES | C[C@H]1CN(/C(=N\C2CCC(=O)CC2)Nc2ccc(C(CC(N)=O)c3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C27H33Cl2N5O2/c1-17-16-34(13-12-31-17)27(33-21-7-9-22(35)10-8-21)32-20-5-2-18(3-6-20)24(15-26(30)36)23-11-4-19(28)14-25(23)29/h2-6,11,14,17,21,24,31H,7-10,12-13,15-16H2,1H3,(H2,30,36)(H,32,33)/t17-,24?/m0/s1 |
| InChIKey | MCLCSYSBDJCQJK-KEJDIYNNSA-N |
| XLogP | 4.57 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|