C30H41Cl2N5O — CID 152769276
N-[2-(2,4-dichlorophenyl)ethyl]-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(3,3,5-trimethylcyclohexyl)carbonimidoyl]amino]benzamide (PubChem CID 152769276) has the molecular formula C30H41Cl2N5O and a molecular weight of 558.60 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(3,3,5-trimethylcyclohexyl)carbonimidoyl]amino]benzamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(3,3,5-trimethylcyclohexyl)carbonimidoyl]amino]benzamide |
|---|---|
| PubChem CID | 152769276 |
| Molecular Formula | C30H41Cl2N5O |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 557.27 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-4-[[C-[(3S)-3-methylpiperazin-1-yl]-N-(3,3,5-trimethylcyclohexyl)carbonimidoyl]amino]benzamide |
| SMILES | CC1CC(/N=C(\Nc2ccc(C(=O)NCCc3ccc(Cl)cc3Cl)cc2)N2CCN[C@@H](C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C30H41Cl2N5O/c1-20-15-26(18-30(3,4)17-20)36-29(37-14-13-33-21(2)19-37)35-25-9-6-23(7-10-25)28(38)34-12-11-22-5-8-24(31)16-27(22)32/h5-10,16,20-21,26,33H,11-15,17-19H2,1-4H3,(H,34,38)(H,35,36)/t20?,21-,26?/m0/s1 |
| InChIKey | UQJRDUGEGYXZSG-WRDKKKNXSA-N |
| XLogP | 6.24 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|