C30H32Cl2N6O — CID 142979314
(3R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3-methylpiperazine-1-carboximidamide (PubChem CID 142979314) has the molecular formula C30H32Cl2N6O and a molecular weight of 563.53 g/mol. Its IUPAC name is (3R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3-methylpiperazine-1-carboximidamide.
| Compound Name | (3R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 142979314 |
| Molecular Formula | C30H32Cl2N6O |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | (3R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3-methylpiperazine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1/N=C(/Nc1ccc2c(=O)n(CCc3ccc(Cl)cc3Cl)cnc2c1)N1CCN[C@H](C)C1 |
| InChI | InChI=1S/C30H32Cl2N6O/c1-19-5-4-6-20(2)28(19)36-30(37-14-12-33-21(3)17-37)35-24-9-10-25-27(16-24)34-18-38(29(25)39)13-11-22-7-8-23(31)15-26(22)32/h4-10,15-16,18,21,33H,11-14,17H2,1-3H3,(H,35,36)/t21-/m1/s1 |
| InChIKey | BPVXDIJVHHLKGS-OAQYLSRUSA-N |
| XLogP | 5.96 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|