C34H43FN6O2 — CID 70899837
(3S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methylpiperazine-1-carboximidamide (PubChem CID 70899837) has the molecular formula C34H43FN6O2 and a molecular weight of 586.76 g/mol. Its IUPAC name is (3S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methylpiperazine-1-carboximidamide.
| Compound Name | (3S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 70899837 |
| Molecular Formula | C34H43FN6O2 |
| Molecular Weight | 586.76 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | (3S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methylpiperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N\C[C@@H]4CC[C@@H]5C(C)(C)C56C[C@@H]46)N4CCN[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C34H43FN6O2/c1-21-19-40(14-12-36-21)32(37-18-23-6-10-30-33(2,3)34(30)17-27(23)34)39-24-7-9-26-29(15-24)38-20-41(31(26)42)13-11-22-5-8-25(43-4)16-28(22)35/h5,7-9,15-16,20-21,23,27,30,36H,6,10-14,17-19H2,1-4H3,(H,37,39)/t21-,23-,27-,30+,34?/m0/s1 |
| InChIKey | BAAZBKPAFXXYHC-HLRZLIQFSA-N |
| XLogP | 4.92 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.76 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|