C31H38FN5O3 — CID 59710409
N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-hydroxy-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide (PubChem CID 59710409) has the molecular formula C31H38FN5O3 and a molecular weight of 547.68 g/mol. Its IUPAC name is N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-hydroxy-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide.
| Compound Name | N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-hydroxy-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 59710409 |
| Molecular Formula | C31H38FN5O3 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.30 |
| IUPAC Name | N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-hydroxy-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N/C4C[C@@H]5C[C@H]([C@@H]4C)C5(C)C)N4CC(O)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C31H38FN5O3/c1-18-25-11-20(31(25,2)3)12-27(18)35-30(37-15-22(38)16-37)34-21-6-8-24-28(13-21)33-17-36(29(24)39)10-9-19-5-7-23(40-4)14-26(19)32/h5-8,13-14,17-18,20,22,25,27,38H,9-12,15-16H2,1-4H3,(H,34,35)/t18-,20-,25+,27?/m0/s1 |
| InChIKey | UMTKKMABEBCFRZ-DOYQPYGSSA-N |
| XLogP | 4.30 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|