C37H51FN6O2 — CID 68594130
N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-4-pentan-3-yl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 68594130) has the molecular formula C37H51FN6O2 and a molecular weight of 630.85 g/mol. Its IUPAC name is N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-4-pentan-3-yl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-4-pentan-3-yl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 68594130 |
| Molecular Formula | C37H51FN6O2 |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 630.41 |
| IUPAC Name | N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-4-pentan-3-yl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | CCC(CC)N1CCN(/C(=N\C2C[C@H]3C[C@H]([C@H]2C)C3(C)C)Nc2ccc3c(=O)n(CCc4ccc(OC)cc4F)cnc3c2)CC1 |
| InChI | InChI=1S/C37H51FN6O2/c1-7-28(8-2)42-15-17-43(18-16-42)36(41-33-20-26-19-31(24(33)3)37(26,4)5)40-27-10-12-30-34(21-27)39-23-44(35(30)45)14-13-25-9-11-29(46-6)22-32(25)38/h9-12,21-24,26,28,31,33H,7-8,13-20H2,1-6H3,(H,40,41)/t24-,26-,31-,33?/m1/s1 |
| InChIKey | HTFYGGAUKMRXIH-KGMJVBFTSA-N |
| XLogP | 6.43 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|