C36H49FN6O2 — CID 69061595
(3S)-3-tert-butyl-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 69061595) has the molecular formula C36H49FN6O2 and a molecular weight of 616.83 g/mol. Its IUPAC name is (3S)-3-tert-butyl-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-3-tert-butyl-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 69061595 |
| Molecular Formula | C36H49FN6O2 |
| Molecular Weight | 616.83 g/mol |
| Exact Mass | 616.39 |
| IUPAC Name | (3S)-3-tert-butyl-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N/[C@H]4C[C@H]5C[C@H]([C@H]4C)C5(C)C)N4CCN[C@@H](C(C)(C)C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C36H49FN6O2/c1-22-28-16-24(36(28,5)6)17-30(22)41-34(42-15-13-38-32(20-42)35(2,3)4)40-25-9-11-27-31(18-25)39-21-43(33(27)44)14-12-23-8-10-26(45-7)19-29(23)37/h8-11,18-19,21-22,24,28,30,32,38H,12-17,20H2,1-7H3,(H,40,41)/t22-,24-,28-,30+,32-/m1/s1 |
| InChIKey | DXAHZOCWKXBQGB-MIWLGESYSA-N |
| XLogP | 5.95 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.83 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|