C34H45FN6O2 — CID 21027502
(3S)-N-[2-[2-(2-fluoro-4-methoxyphenyl)ethyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 21027502) has the molecular formula C34H45FN6O2 and a molecular weight of 588.77 g/mol. Its IUPAC name is (3S)-N-[2-[2-(2-fluoro-4-methoxyphenyl)ethyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[2-[2-(2-fluoro-4-methoxyphenyl)ethyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 21027502 |
| Molecular Formula | C34H45FN6O2 |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | (3S)-N-[2-[2-(2-fluoro-4-methoxyphenyl)ethyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | COc1ccc(CCc2nc3cc(N/C(=N/C4C[C@H]5C[C@@H]([C@@H]4C)C5(C)C)N4CCN[C@@H](C)C4)ccc3c(=O)n2C)c(F)c1 |
| InChI | InChI=1S/C34H45FN6O2/c1-20-19-41(14-13-36-20)33(39-29-16-23-15-27(21(29)2)34(23,3)4)37-24-9-11-26-30(17-24)38-31(40(5)32(26)42)12-8-22-7-10-25(43-6)18-28(22)35/h7,9-11,17-18,20-21,23,27,29,36H,8,12-16,19H2,1-6H3,(H,37,39)/t20-,21-,23+,27-,29?/m0/s1 |
| InChIKey | OXLYXNGYFUEDJW-SPJOBNOMSA-N |
| XLogP | 5.00 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|