C34H45FN6O2 — CID 58620036
(3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 58620036) has the molecular formula C34H45FN6O2 and a molecular weight of 588.77 g/mol. Its IUPAC name is (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 58620036 |
| Molecular Formula | C34H45FN6O2 |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | (3S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-2-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2c(C)nc3cc(N/C(=N/[C@H]4C[C@@H]5C[C@H]([C@@H]4C)C5(C)C)N4CCN[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C34H45FN6O2/c1-20-19-40(14-12-36-20)33(39-30-16-24-15-28(21(30)2)34(24,4)5)38-25-8-10-27-31(17-25)37-22(3)41(32(27)42)13-11-23-7-9-26(43-6)18-29(23)35/h7-10,17-18,20-21,24,28,30,36H,11-16,19H2,1-6H3,(H,38,39)/t20-,21-,24-,28+,30-/m0/s1 |
| InChIKey | SBHIQMOQSHHNAG-YOZIIKJPSA-N |
| XLogP | 5.23 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|