C32H40Cl2N6O2 — CID 59710286
(3S)-N-[2-[(2,4-dichlorophenoxy)methyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 59710286) has the molecular formula C32H40Cl2N6O2 and a molecular weight of 611.62 g/mol. Its IUPAC name is (3S)-N-[2-[(2,4-dichlorophenoxy)methyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[2-[(2,4-dichlorophenoxy)methyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59710286 |
| Molecular Formula | C32H40Cl2N6O2 |
| Molecular Weight | 611.62 g/mol |
| Exact Mass | 610.26 |
| IUPAC Name | (3S)-N-[2-[(2,4-dichlorophenoxy)methyl]-3-methyl-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1C(/N=C(/Nc2ccc3c(=O)n(C)c(COc4ccc(Cl)cc4Cl)nc3c2)N2CCN[C@@H](C)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C32H40Cl2N6O2/c1-18-16-40(11-10-35-18)31(38-26-13-20-12-24(19(26)2)32(20,3)4)36-22-7-8-23-27(15-22)37-29(39(5)30(23)41)17-42-28-9-6-21(33)14-25(28)34/h6-9,14-15,18-20,24,26,35H,10-13,16-17H2,1-5H3,(H,36,38)/t18-,19-,20-,24+,26?/m0/s1 |
| InChIKey | OONKCISMLUCAAS-OZONNIQASA-N |
| XLogP | 5.95 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.62 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|