C36H49FN6O — CID 142834242
(3S)-N-[3-[2-(4-fluorophenyl)ethyl]-2-(2-methylpropyl)-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 142834242) has the molecular formula C36H49FN6O and a molecular weight of 600.83 g/mol. Its IUPAC name is (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-2-(2-methylpropyl)-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-2-(2-methylpropyl)-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 142834242 |
| Molecular Formula | C36H49FN6O |
| Molecular Weight | 600.83 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-2-(2-methylpropyl)-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | CC(C)Cc1nc2cc(N/C(=N/[C@H]3C[C@H]4C[C@@H](C3C)C4(C)C)N3CCN[C@@H](C)C3)ccc2c(=O)n1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C36H49FN6O/c1-22(2)17-33-40-32-20-28(11-12-29(32)34(44)43(33)15-13-25-7-9-27(37)10-8-25)39-35(42-16-14-38-23(3)21-42)41-31-19-26-18-30(24(31)4)36(26,5)6/h7-12,20,22-24,26,30-31,38H,13-19,21H2,1-6H3,(H,39,41)/t23-,24?,26+,30-,31-/m0/s1 |
| InChIKey | QRKDNRCYPOQDHK-IYIRCHKRSA-N |
| XLogP | 6.11 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.83 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|