C32H41FN6O2 — CID 68592635
(3S)-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-hydroxy-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 68592635) has the molecular formula C32H41FN6O2 and a molecular weight of 560.72 g/mol. Its IUPAC name is (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-hydroxy-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-hydroxy-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 68592635 |
| Molecular Formula | C32H41FN6O2 |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.33 |
| IUPAC Name | (3S)-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-hydroxy-3-methyl-N'-[(1S,2S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1C(/N=C(/Nc2ccc3c(=O)n(CCc4ccc(F)cc4)cnc3c2)N2CCN(O)[C@@H](C)C2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C32H41FN6O2/c1-20-18-37(13-14-39(20)41)31(36-28-16-23-15-27(21(28)2)32(23,3)4)35-25-9-10-26-29(17-25)34-19-38(30(26)40)12-11-22-5-7-24(33)8-6-22/h5-10,17,19-21,23,27-28,41H,11-16,18H2,1-4H3,(H,35,36)/t20-,21-,23+,27-,28?/m0/s1 |
| InChIKey | ZQMSEPDJQUKXMI-CHLGNPNUSA-N |
| XLogP | 5.01 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|