C33H42FN5O3 — CID 70899889
(2S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide (PubChem CID 70899889) has the molecular formula C33H42FN5O3 and a molecular weight of 575.73 g/mol. Its IUPAC name is (2S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide.
| Compound Name | (2S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 70899889 |
| Molecular Formula | C33H42FN5O3 |
| Molecular Weight | 575.73 g/mol |
| Exact Mass | 575.33 |
| IUPAC Name | (2S)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2-methyl-N'-[(1R,2S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N/C4C[C@@H]5C[C@H]([C@@H]4C)C5(C)C)N4CCO[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C33H42FN5O3/c1-20-18-38(12-13-42-20)32(37-29-15-23-14-27(21(29)2)33(23,3)4)36-24-7-9-26-30(16-24)35-19-39(31(26)40)11-10-22-6-8-25(41-5)17-28(22)34/h6-9,16-17,19-21,23,27,29H,10-15,18H2,1-5H3,(H,36,37)/t20-,21-,23-,27+,29?/m0/s1 |
| InChIKey | VNWULACAFIAGMS-YOKUSKGWSA-N |
| XLogP | 5.35 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|