C34H44FN5O3 — CID 69057563
(2S,6R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2,6-dimethyl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide (PubChem CID 69057563) has the molecular formula C34H44FN5O3 and a molecular weight of 589.76 g/mol. Its IUPAC name is (2S,6R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2,6-dimethyl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide.
| Compound Name | (2S,6R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2,6-dimethyl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 69057563 |
| Molecular Formula | C34H44FN5O3 |
| Molecular Weight | 589.76 g/mol |
| Exact Mass | 589.34 |
| IUPAC Name | (2S,6R)-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-2,6-dimethyl-N'-[(1R,2R,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]morpholine-4-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N/C4C[C@H]5C[C@H]([C@H]4C)C5(C)C)N4C[C@@H](C)O[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C34H44FN5O3/c1-20-17-40(18-21(2)43-20)33(38-30-14-24-13-28(22(30)3)34(24,4)5)37-25-8-10-27-31(15-25)36-19-39(32(27)41)12-11-23-7-9-26(42-6)16-29(23)35/h7-10,15-16,19-22,24,28,30H,11-14,17-18H2,1-6H3,(H,37,38)/t20-,21+,22-,24-,28-,30?/m1/s1 |
| InChIKey | KLXGHRJLILYZQV-QPNCEQFASA-N |
| XLogP | 5.73 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|