C30H37FN6O — CID 68593460
3-amino-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide (PubChem CID 68593460) has the molecular formula C30H37FN6O and a molecular weight of 516.67 g/mol. Its IUPAC name is 3-amino-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide.
| Compound Name | 3-amino-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 68593460 |
| Molecular Formula | C30H37FN6O |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3-amino-N-[3-[2-(4-fluorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]azetidine-1-carboximidamide |
| SMILES | C[C@H]1[C@@H](/N=C(/Nc2ccc3c(=O)n(CCc4ccc(F)cc4)cnc3c2)N2CC(N)C2)C[C@@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C30H37FN6O/c1-18-25-12-20(30(25,2)3)13-26(18)35-29(37-15-22(32)16-37)34-23-8-9-24-27(14-23)33-17-36(28(24)38)11-10-19-4-6-21(31)7-5-19/h4-9,14,17-18,20,22,25-26H,10-13,15-16,32H2,1-3H3,(H,34,35)/t18-,20+,25+,26+/m1/s1 |
| InChIKey | BRQQEHKNUWOUHL-XCUDUSTGSA-N |
| XLogP | 4.26 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|