C33H42Cl2N6O — CID 59710289
(3S,5R)-N-[3-[2-(3,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 59710289) has the molecular formula C33H42Cl2N6O and a molecular weight of 609.65 g/mol. Its IUPAC name is (3S,5R)-N-[3-[2-(3,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | (3S,5R)-N-[3-[2-(3,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59710289 |
| Molecular Formula | C33H42Cl2N6O |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 608.28 |
| IUPAC Name | (3S,5R)-N-[3-[2-(3,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethyl-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | C[C@@H]1[C@@H](/N=C(/Nc2ccc3c(=O)n(CCc4ccc(Cl)c(Cl)c4)cnc3c2)N2C[C@@H](C)N[C@@H](C)C2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C33H42Cl2N6O/c1-19-16-41(17-20(2)37-19)32(39-29-14-23-13-26(21(29)3)33(23,4)5)38-24-7-8-25-30(15-24)36-18-40(31(25)42)11-10-22-6-9-27(34)28(35)12-22/h6-9,12,15,18-21,23,26,29,37H,10-11,13-14,16-17H2,1-5H3,(H,38,39)/t19-,20+,21-,23-,26+,29-/m0/s1 |
| InChIKey | JYLXCZQKRKXGEZ-MKJCNZGDSA-N |
| XLogP | 6.47 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|