C28H33FN4O2S — CID 87509898
1-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea (PubChem CID 87509898) has the molecular formula C28H33FN4O2S and a molecular weight of 508.66 g/mol. Its IUPAC name is 1-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea.
| Compound Name | 1-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea |
|---|---|
| PubChem CID | 87509898 |
| Molecular Formula | C28H33FN4O2S |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3-[(1S,2R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]thiourea |
| SMILES | COc1ccc(CCn2cnc3cc(NC(=S)N[C@H]4C[C@@H]5C[C@@H]([C@H]4C)C5(C)C)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C28H33FN4O2S/c1-16-22-11-18(28(22,2)3)12-24(16)32-27(36)31-19-6-8-21-25(13-19)30-15-33(26(21)34)10-9-17-5-7-20(35-4)14-23(17)29/h5-8,13-16,18,22,24H,9-12H2,1-4H3,(H2,31,32,36)/t16-,18+,22+,24+/m1/s1 |
| InChIKey | AUDQMCULSZOJII-IXPCADFXSA-N |
| XLogP | 5.14 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|