C29H36FN7O2 — CID 59710189
[[N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamimidoyl]amino]urea (PubChem CID 59710189) has the molecular formula C29H36FN7O2 and a molecular weight of 533.65 g/mol. Its IUPAC name is [[N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamimidoyl]amino]urea.
| Compound Name | [[N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamimidoyl]amino]urea |
|---|---|
| PubChem CID | 59710189 |
| Molecular Formula | C29H36FN7O2 |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | [[N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]carbamimidoyl]amino]urea |
| SMILES | Cc1ccc(CCn2cnc3cc(N/C(=N/[C@H]4C[C@@H]5C[C@H]([C@@H]4C)C5(C)C)NNC(N)=O)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C29H36FN7O2/c1-16-5-6-18(23(30)11-16)9-10-37-15-32-25-14-20(7-8-21(25)26(37)38)33-28(36-35-27(31)39)34-24-13-19-12-22(17(24)2)29(19,3)4/h5-8,11,14-15,17,19,22,24H,9-10,12-13H2,1-4H3,(H3,31,35,39)(H2,33,34,36)/t17-,19-,22+,24-/m0/s1 |
| InChIKey | PANHDDVGFLXVFC-FJYDYCOSSA-N |
| XLogP | 4.10 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|