C32H39FN6O — CID 70899846
(4S)-N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,5-diazabicyclo[2.2.0]hexane-2-carboximidamide (PubChem CID 70899846) has the molecular formula C32H39FN6O and a molecular weight of 542.70 g/mol. Its IUPAC name is (4S)-N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,5-diazabicyclo[2.2.0]hexane-2-carboximidamide.
| Compound Name | (4S)-N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,5-diazabicyclo[2.2.0]hexane-2-carboximidamide |
|---|---|
| PubChem CID | 70899846 |
| Molecular Formula | C32H39FN6O |
| Molecular Weight | 542.70 g/mol |
| Exact Mass | 542.32 |
| IUPAC Name | (4S)-N-[3-[2-(2-fluoro-4-methylphenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-2,5-diazabicyclo[2.2.0]hexane-2-carboximidamide |
| SMILES | Cc1ccc(CCn2cnc3cc(N/C(=N/[C@H]4C[C@@H]5C[C@H](C4C)C5(C)C)N4C[C@@H]5NCC54)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C32H39FN6O/c1-18-5-6-20(25(33)11-18)9-10-38-17-35-27-14-22(7-8-23(27)30(38)40)36-31(39-16-28-29(39)15-34-28)37-26-13-21-12-24(19(26)2)32(21,3)4/h5-8,11,14,17,19,21,24,26,28-29,34H,9-10,12-13,15-16H2,1-4H3,(H,36,37)/t19?,21-,24+,26-,28-,29?/m0/s1 |
| InChIKey | CHFVAZSNDVLEIC-RMQHDAQDSA-N |
| XLogP | 4.58 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.70 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|