C35H45FN6O2 — CID 59710148
(3R,5S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 59710148) has the molecular formula C35H45FN6O2 and a molecular weight of 600.78 g/mol. Its IUPAC name is (3R,5S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethylpiperazine-1-carboximidamide.
| Compound Name | (3R,5S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59710148 |
| Molecular Formula | C35H45FN6O2 |
| Molecular Weight | 600.78 g/mol |
| Exact Mass | 600.36 |
| IUPAC Name | (3R,5S)-N'-[[(3S,4R,7R)-8,8-dimethyl-4-tricyclo[5.1.0.01,3]octanyl]methyl]-N-[3-[2-(2-fluoro-4-methoxyphenyl)ethyl]-4-oxoquinazolin-7-yl]-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | COc1ccc(CCn2cnc3cc(N/C(=N\C[C@@H]4CC[C@@H]5C(C)(C)C56C[C@@H]46)N4C[C@@H](C)N[C@@H](C)C4)ccc3c2=O)c(F)c1 |
| InChI | InChI=1S/C35H45FN6O2/c1-21-18-42(19-22(2)39-21)33(37-17-24-7-11-31-34(3,4)35(31)16-28(24)35)40-25-8-10-27-30(14-25)38-20-41(32(27)43)13-12-23-6-9-26(44-5)15-29(23)36/h6,8-10,14-15,20-22,24,28,31,39H,7,11-13,16-19H2,1-5H3,(H,37,40)/t21-,22+,24-,28-,31+,35?/m0/s1 |
| InChIKey | VUYQCYYLMVQCEV-TUUWUARTSA-N |
| XLogP | 5.31 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.78 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|