C31H41ClN6O — CID 59710173
(3S)-N-[3-[2-(4-chlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S)-2,4,4-trimethylcyclohexyl]piperazine-1-carboximidamide (PubChem CID 59710173) has the molecular formula C31H41ClN6O and a molecular weight of 549.16 g/mol. Its IUPAC name is (3S)-N-[3-[2-(4-chlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S)-2,4,4-trimethylcyclohexyl]piperazine-1-carboximidamide.
| Compound Name | (3S)-N-[3-[2-(4-chlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S)-2,4,4-trimethylcyclohexyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59710173 |
| Molecular Formula | C31H41ClN6O |
| Molecular Weight | 549.16 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | (3S)-N-[3-[2-(4-chlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-methyl-N'-[(1S,2S)-2,4,4-trimethylcyclohexyl]piperazine-1-carboximidamide |
| SMILES | C[C@H]1CN(/C(=N\[C@H]2CCC(C)(C)C[C@@H]2C)Nc2ccc3c(=O)n(CCc4ccc(Cl)cc4)cnc3c2)CCN1 |
| InChI | InChI=1S/C31H41ClN6O/c1-21-18-31(3,4)13-11-27(21)36-30(37-16-14-33-22(2)19-37)35-25-9-10-26-28(17-25)34-20-38(29(26)39)15-12-23-5-7-24(32)8-6-23/h5-10,17,20-22,27,33H,11-16,18-19H2,1-4H3,(H,35,36)/t21-,22-,27-/m0/s1 |
| InChIKey | VNAUXTVQDABEHE-BERHBOFZSA-N |
| XLogP | 5.57 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.16 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|