C31H34Cl2N6O — CID 59710284
(3S,5R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 59710284) has the molecular formula C31H34Cl2N6O and a molecular weight of 577.56 g/mol. Its IUPAC name is (3S,5R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3,5-dimethylpiperazine-1-carboximidamide.
| Compound Name | (3S,5R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3,5-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 59710284 |
| Molecular Formula | C31H34Cl2N6O |
| Molecular Weight | 577.56 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | (3S,5R)-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-(2,6-dimethylphenyl)-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | Cc1cccc(C)c1/N=C(/Nc1ccc2c(=O)n(CCc3ccc(Cl)cc3Cl)cnc2c1)N1C[C@@H](C)N[C@@H](C)C1 |
| InChI | InChI=1S/C31H34Cl2N6O/c1-19-6-5-7-20(2)29(19)37-31(39-16-21(3)35-22(4)17-39)36-25-10-11-26-28(15-25)34-18-38(30(26)40)13-12-23-8-9-24(32)14-27(23)33/h5-11,14-15,18,21-22,35H,12-13,16-17H2,1-4H3,(H,36,37)/t21-,22+ |
| InChIKey | WGAVWAUFDCLWLW-SZPZYZBQSA-N |
| XLogP | 6.34 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.56 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|