C37H42Cl2N6O — CID 70950079
N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-phenyl-N'-[(1R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide (PubChem CID 70950079) has the molecular formula C37H42Cl2N6O and a molecular weight of 657.69 g/mol. Its IUPAC name is N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-phenyl-N'-[(1R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide.
| Compound Name | N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-phenyl-N'-[(1R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 70950079 |
| Molecular Formula | C37H42Cl2N6O |
| Molecular Weight | 657.69 g/mol |
| Exact Mass | 656.28 |
| IUPAC Name | N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-4-phenyl-N'-[(1R,3S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperazine-1-carboximidamide |
| SMILES | CC1[C@@H](/N=C(/Nc2ccc3c(=O)n(CCc4ccc(Cl)cc4Cl)cnc3c2)N2CCN(c3ccccc3)CC2)CC2C[C@H]1C2(C)C |
| InChI | InChI=1S/C37H42Cl2N6O/c1-24-31-19-26(37(31,2)3)20-33(24)42-36(44-17-15-43(16-18-44)29-7-5-4-6-8-29)41-28-11-12-30-34(22-28)40-23-45(35(30)46)14-13-25-9-10-27(38)21-32(25)39/h4-12,21-24,26,31,33H,13-20H2,1-3H3,(H,41,42)/t24?,26?,31-,33+/m1/s1 |
| InChIKey | PXWXAIQKPRMPJY-MCDVRHDZSA-N |
| XLogP | 7.61 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.69 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|