C39H45Cl2N5O — CID 59710188
4-benzyl-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperidine-1-carboximidamide (PubChem CID 59710188) has the molecular formula C39H45Cl2N5O and a molecular weight of 670.73 g/mol. Its IUPAC name is 4-benzyl-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperidine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 59710188 |
| Molecular Formula | C39H45Cl2N5O |
| Molecular Weight | 670.73 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 4-benzyl-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-N'-[(1R,2S,3S,5S)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]piperidine-1-carboximidamide |
| SMILES | C[C@@H]1[C@@H](/N=C(/Nc2ccc3c(=O)n(CCc4ccc(Cl)cc4Cl)cnc3c2)N2CCC(Cc3ccccc3)CC2)C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C39H45Cl2N5O/c1-25-33-20-29(39(33,2)3)21-35(25)44-38(45-16-13-27(14-17-45)19-26-7-5-4-6-8-26)43-31-11-12-32-36(23-31)42-24-46(37(32)47)18-15-28-9-10-30(40)22-34(28)41/h4-12,22-25,27,29,33,35H,13-21H2,1-3H3,(H,43,44)/t25-,29-,33+,35-/m0/s1 |
| InChIKey | UEYUVRJBUVRJAP-CQCUDMRBSA-N |
| XLogP | 8.74 |
| TPSA | 62.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.73 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|