C31H38Cl2N6O — CID 143055471
(3S)-N'-[(1R)-1-cyclohexylethyl]-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-ethenylpiperazine-1-carboximidamide (PubChem CID 143055471) has the molecular formula C31H38Cl2N6O and a molecular weight of 581.59 g/mol. Its IUPAC name is (3S)-N'-[(1R)-1-cyclohexylethyl]-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-ethenylpiperazine-1-carboximidamide.
| Compound Name | (3S)-N'-[(1R)-1-cyclohexylethyl]-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-ethenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143055471 |
| Molecular Formula | C31H38Cl2N6O |
| Molecular Weight | 581.59 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | (3S)-N'-[(1R)-1-cyclohexylethyl]-N-[3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-3-ethenylpiperazine-1-carboximidamide |
| SMILES | C=C[C@H]1CN(/C(=N\[C@H](C)C2CCCCC2)Nc2ccc3c(=O)n(CCc4ccc(Cl)cc4Cl)cnc3c2)CCN1 |
| InChI | InChI=1S/C31H38Cl2N6O/c1-3-25-19-38(16-14-34-25)31(36-21(2)22-7-5-4-6-8-22)37-26-11-12-27-29(18-26)35-20-39(30(27)40)15-13-23-9-10-24(32)17-28(23)33/h3,9-12,17-18,20-22,25,34H,1,4-8,13-16,19H2,2H3,(H,36,37)/t21-,25+/m1/s1 |
| InChIKey | VLSVBTHYHBLVNF-BWKNWUBXSA-N |
| XLogP | 6.14 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|