C27H36Cl2N6O — CID 10152730
N-[4-[[N'-cyclohexyl-N-(3-methylpiperazin-1-yl)carbamimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide (PubChem CID 10152730) has the molecular formula C27H36Cl2N6O and a molecular weight of 531.53 g/mol. Its IUPAC name is N-[4-[[N'-cyclohexyl-N-(3-methylpiperazin-1-yl)carbamimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide.
| Compound Name | N-[4-[[N'-cyclohexyl-N-(3-methylpiperazin-1-yl)carbamimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 10152730 |
| Molecular Formula | C27H36Cl2N6O |
| Molecular Weight | 531.53 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | N-[4-[[N'-cyclohexyl-N-(3-methylpiperazin-1-yl)carbamimidoyl]amino]phenyl]-3-(2,4-dichlorophenyl)propanamide |
| SMILES | CC1CN(N/C(=N\C2CCCCC2)Nc2ccc(NC(=O)CCc3ccc(Cl)cc3Cl)cc2)CCN1 |
| InChI | InChI=1S/C27H36Cl2N6O/c1-19-18-35(16-15-30-19)34-27(32-22-5-3-2-4-6-22)33-24-12-10-23(11-13-24)31-26(36)14-8-20-7-9-21(28)17-25(20)29/h7,9-13,17,19,22,30H,2-6,8,14-16,18H2,1H3,(H,31,36)(H2,32,33,34) |
| InChIKey | UZISOQSKZAHUJC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|