C29H38Cl3N5O — CID 174486191
5-chloro-4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-2-methylbenzamide (PubChem CID 174486191) has the molecular formula C29H38Cl3N5O and a molecular weight of 579.02 g/mol. Its IUPAC name is 5-chloro-4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-2-methylbenzamide.
| Compound Name | 5-chloro-4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 174486191 |
| Molecular Formula | C29H38Cl3N5O |
| Molecular Weight | 579.02 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | 5-chloro-4-[[N-cyclohexyl-C-(3,5-dimethylpiperazin-1-yl)carbonimidoyl]amino]-N-[2-(2,4-dichlorophenyl)ethyl]-2-methylbenzamide |
| SMILES | Cc1cc(N/C(=N/C2CCCCC2)N2CC(C)NC(C)C2)c(Cl)cc1C(=O)NCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H38Cl3N5O/c1-18-13-27(26(32)15-24(18)28(38)33-12-11-21-9-10-22(30)14-25(21)31)36-29(35-23-7-5-4-6-8-23)37-16-19(2)34-20(3)17-37/h9-10,13-15,19-20,23,34H,4-8,11-12,16-17H2,1-3H3,(H,33,38)(H,35,36) |
| InChIKey | DETHVEYXFIIFRG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.02 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|