C23H38N4O — CID 134099665
N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclohexyl-3,5-dimethylpiperazine-1-carboximidamide (PubChem CID 134099665) has the molecular formula C23H38N4O and a molecular weight of 386.58 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclohexyl-3,5-dimethylpiperazine-1-carboximidamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclohexyl-3,5-dimethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134099665 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclohexyl-3,5-dimethylpiperazine-1-carboximidamide |
| SMILES | CC1CN(/C(=N\C2CCCCC2)Nc2cc(C(C)(C)C)ccc2O)CC(C)N1 |
| InChI | InChI=1S/C23H38N4O/c1-16-14-27(15-17(2)24-16)22(25-19-9-7-6-8-10-19)26-20-13-18(23(3,4)5)11-12-21(20)28/h11-13,16-17,19,24,28H,6-10,14-15H2,1-5H3,(H,25,26) |
| InChIKey | BCINKAIHMISUKI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|