C19H29N3O — CID 134121786
N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclopropylpiperidine-1-carboximidamide (PubChem CID 134121786) has the molecular formula C19H29N3O and a molecular weight of 315.46 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclopropylpiperidine-1-carboximidamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclopropylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134121786 |
| Molecular Formula | C19H29N3O |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.23 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-N'-cyclopropylpiperidine-1-carboximidamide |
| SMILES | CC(C)(C)c1ccc(O)c(N/C(=N/C2CC2)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H29N3O/c1-19(2,3)14-7-10-17(23)16(13-14)21-18(20-15-8-9-15)22-11-5-4-6-12-22/h7,10,13,15,23H,4-6,8-9,11-12H2,1-3H3,(H,20,21) |
| InChIKey | MXDUZDKZNQSRPI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|