C22H32N4O2S — CID 134088818
N-(5-tert-butyl-2-hydroxyphenyl)-4-(2-hydroxyethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 134088818) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-4-(2-hydroxyethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-4-(2-hydroxyethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134088818 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-4-(2-hydroxyethyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CC(C)(C)c1ccc(O)c(N/C(=N/Cc2cccs2)N2CCN(CCO)CC2)c1 |
| InChI | InChI=1S/C22H32N4O2S/c1-22(2,3)17-6-7-20(28)19(15-17)24-21(23-16-18-5-4-14-29-18)26-10-8-25(9-11-26)12-13-27/h4-7,14-15,27-28H,8-13,16H2,1-3H3,(H,23,24) |
| InChIKey | MDHYLJMIGXKPQR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|