C14H23N3S — CID 111209931
N-ethyl-4-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 111209931) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is N-ethyl-4-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-4-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111209931 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | N-ethyl-4-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C14H23N3S/c1-3-15-14(16-11-13-5-4-10-18-13)17-8-6-12(2)7-9-17/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,15,16) |
| InChIKey | IHXCSHVPYGODBE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|