C22H31N3OS — CID 134088813
N-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide (PubChem CID 134088813) has the molecular formula C22H31N3OS and a molecular weight of 385.58 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134088813 |
| Molecular Formula | C22H31N3OS |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-methyl-N'-(thiophen-2-ylmethyl)piperidine-1-carboximidamide |
| SMILES | CC1CCCCN1/C(=N\Cc1cccs1)Nc1cc(C(C)(C)C)ccc1O |
| InChI | InChI=1S/C22H31N3OS/c1-16-8-5-6-12-25(16)21(23-15-18-9-7-13-27-18)24-19-14-17(22(2,3)4)10-11-20(19)26/h7,9-11,13-14,16,26H,5-6,8,12,15H2,1-4H3,(H,23,24) |
| InChIKey | ZOHXQCNYAJGZLG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|