C20H24BrFN4O2 — CID 134121801
N'-[(5-bromo-2-fluorophenyl)methyl]-4-(2-hydroxyethyl)-N-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 134121801) has the molecular formula C20H24BrFN4O2 and a molecular weight of 451.34 g/mol. Its IUPAC name is N'-[(5-bromo-2-fluorophenyl)methyl]-4-(2-hydroxyethyl)-N-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(5-bromo-2-fluorophenyl)methyl]-4-(2-hydroxyethyl)-N-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134121801 |
| Molecular Formula | C20H24BrFN4O2 |
| Molecular Weight | 451.34 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N'-[(5-bromo-2-fluorophenyl)methyl]-4-(2-hydroxyethyl)-N-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | OCCN1CCN(/C(=N\Cc2cc(Br)ccc2F)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C20H24BrFN4O2/c21-16-5-6-17(22)15(13-16)14-23-20(24-18-3-1-2-4-19(18)28)26-9-7-25(8-10-26)11-12-27/h1-6,13,27-28H,7-12,14H2,(H,23,24) |
| InChIKey | LKBVULHPCIAPNH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|