C19H22BrFN4O — CID 134121772
N'-[(5-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide (PubChem CID 134121772) has the molecular formula C19H22BrFN4O and a molecular weight of 421.31 g/mol. Its IUPAC name is N'-[(5-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide.
| Compound Name | N'-[(5-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134121772 |
| Molecular Formula | C19H22BrFN4O |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | N'-[(5-bromo-2-fluorophenyl)methyl]-N-(2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide |
| SMILES | CN1CCN(/C(=N\Cc2cc(Br)ccc2F)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C19H22BrFN4O/c1-24-8-10-25(11-9-24)19(23-17-4-2-3-5-18(17)26)22-13-14-12-15(20)6-7-16(14)21/h2-7,12,26H,8-11,13H2,1H3,(H,22,23) |
| InChIKey | GZJTTXWJXYAWFE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|