C15H25N5S — CID 134088767
N'-(2-aminoethyl)-4-methyl-N-(2-methylsulfanylphenyl)piperazine-1-carboximidamide (PubChem CID 134088767) has the molecular formula C15H25N5S and a molecular weight of 307.47 g/mol. Its IUPAC name is N'-(2-aminoethyl)-4-methyl-N-(2-methylsulfanylphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-(2-aminoethyl)-4-methyl-N-(2-methylsulfanylphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134088767 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | N'-(2-aminoethyl)-4-methyl-N-(2-methylsulfanylphenyl)piperazine-1-carboximidamide |
| SMILES | CSc1ccccc1N/C(=N/CCN)N1CCN(C)CC1 |
| InChI | InChI=1S/C15H25N5S/c1-19-9-11-20(12-10-19)15(17-8-7-16)18-13-5-3-4-6-14(13)21-2/h3-6H,7-12,16H2,1-2H3,(H,17,18) |
| InChIKey | TUDTZBUTDKQEHJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|