C25H40N4OS — CID 134091987
N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-N-(2-methylsulfanylphenyl)morpholine-4-carboximidamide (PubChem CID 134091987) has the molecular formula C25H40N4OS and a molecular weight of 444.69 g/mol. Its IUPAC name is N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-N-(2-methylsulfanylphenyl)morpholine-4-carboximidamide.
| Compound Name | N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-N-(2-methylsulfanylphenyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 134091987 |
| Molecular Formula | C25H40N4OS |
| Molecular Weight | 444.69 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-N-(2-methylsulfanylphenyl)morpholine-4-carboximidamide |
| SMILES | CSc1ccccc1N/C(=N/C1CCC(CC2CCC(N)CC2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C25H40N4OS/c1-31-24-5-3-2-4-23(24)28-25(29-14-16-30-17-15-29)27-22-12-8-20(9-13-22)18-19-6-10-21(26)11-7-19/h2-5,19-22H,6-18,26H2,1H3,(H,27,28) |
| InChIKey | WPUXNOJMZIECSZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|