C27H44N4S — CID 134091993
N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-2-methyl-N-(2-methylsulfanylphenyl)piperidine-1-carboximidamide (PubChem CID 134091993) has the molecular formula C27H44N4S and a molecular weight of 456.74 g/mol. Its IUPAC name is N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-2-methyl-N-(2-methylsulfanylphenyl)piperidine-1-carboximidamide.
| Compound Name | N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-2-methyl-N-(2-methylsulfanylphenyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 134091993 |
| Molecular Formula | C27H44N4S |
| Molecular Weight | 456.74 g/mol |
| Exact Mass | 456.33 |
| IUPAC Name | N'-[4-[(4-aminocyclohexyl)methyl]cyclohexyl]-2-methyl-N-(2-methylsulfanylphenyl)piperidine-1-carboximidamide |
| SMILES | CSc1ccccc1N/C(=N/C1CCC(CC2CCC(N)CC2)CC1)N1CCCCC1C |
| InChI | InChI=1S/C27H44N4S/c1-20-7-5-6-18-31(20)27(30-25-8-3-4-9-26(25)32-2)29-24-16-12-22(13-17-24)19-21-10-14-23(28)15-11-21/h3-4,8-9,20-24H,5-7,10-19,28H2,1-2H3,(H,29,30) |
| InChIKey | UWYPLYVPTRRNFZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.74 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|