C16H25N2OS+ — CID 8876075
cyclopentyl-dimethyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium (PubChem CID 8876075) has the molecular formula C16H25N2OS+ and a molecular weight of 293.46 g/mol. Its IUPAC name is cyclopentyl-dimethyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium.
| Compound Name | cyclopentyl-dimethyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8876075 |
| Molecular Formula | C16H25N2OS+ |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | cyclopentyl-dimethyl-[2-(2-methylsulfanylanilino)-2-oxoethyl]azanium |
| SMILES | CSc1ccccc1NC(=O)C[N+](C)(C)C1CCCC1 |
| InChI | InChI=1S/C16H24N2OS/c1-18(2,13-8-4-5-9-13)12-16(19)17-14-10-6-7-11-15(14)20-3/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3/p+1 |
| InChIKey | AIGAZCKRZRXHDQ-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|