C17H24N2O3S — CID 50960888
N'-(2-methylsulfanylphenyl)-N-(oxan-2-ylmethyl)butanediamide (PubChem CID 50960888) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N'-(2-methylsulfanylphenyl)-N-(oxan-2-ylmethyl)butanediamide.
| Compound Name | N'-(2-methylsulfanylphenyl)-N-(oxan-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 50960888 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N'-(2-methylsulfanylphenyl)-N-(oxan-2-ylmethyl)butanediamide |
| SMILES | CSc1ccccc1NC(=O)CCC(=O)NCC1CCCCO1 |
| InChI | InChI=1S/C17H24N2O3S/c1-23-15-8-3-2-7-14(15)19-17(21)10-9-16(20)18-12-13-6-4-5-11-22-13/h2-3,7-8,13H,4-6,9-12H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | XPQJEFKDJIYLQU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |