C10H10N2OS — CID 82672014
2-cyano-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 82672014) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-cyano-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-cyano-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 82672014 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-cyano-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CC#N |
| InChI | InChI=1S/C10H10N2OS/c1-14-9-5-3-2-4-8(9)12-10(13)6-7-11/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | OZSFEOJPQAAGIG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |