C17H27FN4O2 — CID 134111489
N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide (PubChem CID 134111489) has the molecular formula C17H27FN4O2 and a molecular weight of 338.43 g/mol. Its IUPAC name is N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide.
| Compound Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 134111489 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | N'-(3-ethoxypropyl)-N-(5-fluoro-2-hydroxyphenyl)-4-methylpiperazine-1-carboximidamide |
| SMILES | CCOCCC/N=C(/Nc1cc(F)ccc1O)N1CCN(C)CC1 |
| InChI | InChI=1S/C17H27FN4O2/c1-3-24-12-4-7-19-17(22-10-8-21(2)9-11-22)20-15-13-14(18)5-6-16(15)23/h5-6,13,23H,3-4,7-12H2,1-2H3,(H,19,20) |
| InChIKey | XVCHPOKBUSOHSO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|